C23H19N5O7S2 — CID 46370248
N-[(3-nitrophenyl)methyl]-N-[2-[(3-nitrophenyl)methylsulfanyl]-4-oxoquinazolin-3-yl]methanesulfonamide (PubChem CID 46370248) has the molecular formula C23H19N5O7S2 and a molecular weight of 541.57 g/mol. Its IUPAC name is N-[(3-nitrophenyl)methyl]-N-[2-[(3-nitrophenyl)methylsulfanyl]-4-oxoquinazolin-3-yl]methanesulfonamide.
| Compound Name | N-[(3-nitrophenyl)methyl]-N-[2-[(3-nitrophenyl)methylsulfanyl]-4-oxoquinazolin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 46370248 |
| Molecular Formula | C23H19N5O7S2 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | N-[(3-nitrophenyl)methyl]-N-[2-[(3-nitrophenyl)methylsulfanyl]-4-oxoquinazolin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1cccc([N+](=O)[O-])c1)n1c(SCc2cccc([N+](=O)[O-])c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H19N5O7S2/c1-37(34,35)25(14-16-6-4-8-18(12-16)27(30)31)26-22(29)20-10-2-3-11-21(20)24-23(26)36-15-17-7-5-9-19(13-17)28(32)33/h2-13H,14-15H2,1H3 |
| InChIKey | UWGBUGPPBVRMKU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 158.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|