C30H27BrFN3O4S2 — CID 46371443
3-[(4-bromophenyl)carbamothioyl-(2-phenylethyl)sulfamoyl]-N-(2-ethoxyphenyl)-4-fluorobenzamide (PubChem CID 46371443) has the molecular formula C30H27BrFN3O4S2 and a molecular weight of 656.60 g/mol. Its IUPAC name is 3-[(4-bromophenyl)carbamothioyl-(2-phenylethyl)sulfamoyl]-N-(2-ethoxyphenyl)-4-fluorobenzamide.
| Compound Name | 3-[(4-bromophenyl)carbamothioyl-(2-phenylethyl)sulfamoyl]-N-(2-ethoxyphenyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 46371443 |
| Molecular Formula | C30H27BrFN3O4S2 |
| Molecular Weight | 656.60 g/mol |
| Exact Mass | 655.06 |
| IUPAC Name | 3-[(4-bromophenyl)carbamothioyl-(2-phenylethyl)sulfamoyl]-N-(2-ethoxyphenyl)-4-fluorobenzamide |
| SMILES | CCOc1ccccc1NC(=O)c1ccc(F)c(S(=O)(=O)N(CCc2ccccc2)C(=S)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C30H27BrFN3O4S2/c1-2-39-27-11-7-6-10-26(27)34-29(36)22-12-17-25(32)28(20-22)41(37,38)35(19-18-21-8-4-3-5-9-21)30(40)33-24-15-13-23(31)14-16-24/h3-17,20H,2,18-19H2,1H3,(H,33,40)(H,34,36) |
| InChIKey | HPAUPARSDWJTMY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.60 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|