C21H24FN3O5S — CID 5058623
1-[5-[(2-ethoxyphenyl)carbamoyl]-2-fluorophenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 5058623) has the molecular formula C21H24FN3O5S and a molecular weight of 449.50 g/mol. Its IUPAC name is 1-[5-[(2-ethoxyphenyl)carbamoyl]-2-fluorophenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-[5-[(2-ethoxyphenyl)carbamoyl]-2-fluorophenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 5058623 |
| Molecular Formula | C21H24FN3O5S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 1-[5-[(2-ethoxyphenyl)carbamoyl]-2-fluorophenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1ccc(F)c(S(=O)(=O)N2CCC(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C21H24FN3O5S/c1-2-30-18-6-4-3-5-17(18)24-21(27)15-7-8-16(22)19(13-15)31(28,29)25-11-9-14(10-12-25)20(23)26/h3-8,13-14H,2,9-12H2,1H3,(H2,23,26)(H,24,27) |
| InChIKey | MUICTJJWJTYATG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |