C17H20FN3O3S — CID 46379145
1-(4-ethoxyphenyl)-2-[(3-fluorophenyl)methyl]-3-methylsulfonylguanidine (PubChem CID 46379145) has the molecular formula C17H20FN3O3S and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2-[(3-fluorophenyl)methyl]-3-methylsulfonylguanidine.
| Compound Name | 1-(4-ethoxyphenyl)-2-[(3-fluorophenyl)methyl]-3-methylsulfonylguanidine |
|---|---|
| PubChem CID | 46379145 |
| Molecular Formula | C17H20FN3O3S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2-[(3-fluorophenyl)methyl]-3-methylsulfonylguanidine |
| SMILES | CCOc1ccc(N/C(=N/Cc2cccc(F)c2)NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H20FN3O3S/c1-3-24-16-9-7-15(8-10-16)20-17(21-25(2,22)23)19-12-13-5-4-6-14(18)11-13/h4-11H,3,12H2,1-2H3,(H2,19,20,21) |
| InChIKey | RVZHPWIQXIBJCC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|