C17H20FN3O4S — CID 46379169
1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine (PubChem CID 46379169) has the molecular formula C17H20FN3O4S and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine |
|---|---|
| PubChem CID | 46379169 |
| Molecular Formula | C17H20FN3O4S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine |
| SMILES | COc1ccc(N/C(=N/Cc2ccc(F)cc2)NS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C17H20FN3O4S/c1-24-15-9-8-14(10-16(15)25-2)20-17(21-26(3,22)23)19-11-12-4-6-13(18)7-5-12/h4-10H,11H2,1-3H3,(H2,19,20,21) |
| InChIKey | IUUINQDRVPHACU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|