About 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine
1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine (PubChem CID 46379169) has the molecular formula C17H20FN3O4S
and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine.
Molecular Properties
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine |
| PubChem CID | 46379169 |
| Molecular Formula | C17H20FN3O4S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine |
| SMILES | COc1ccc(N/C(=N/Cc2ccc(F)cc2)NS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C17H20FN3O4S/c1-24-15-9-8-14(10-16(15)25-2)20-17(21-26(3,22)23)19-11-12-4-6-13(18)7-5-12/h4-10H,11H2,1-3H3,(H2,19,20,21) |
| InChIKey | IUUINQDRVPHACU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine?
The IUPAC name of 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine (CID 46379169) is 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine.
What is the SMILES notation for 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine?
The canonical SMILES for 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine is COc1ccc(N/C(=N/Cc2ccc(F)cc2)NS(C)(=O)=O)cc1OC.
What is the InChIKey of 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine?
The InChIKey is IUUINQDRVPHACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN3O4S/c1-24-15-9-8-14(10-16(15)25-2)20-17(21-26(3,22)23)19-11-12-4-6-13(18)7-5-12/h4-10H,11H2,1-3H3,(H2,19,20,21).
What are the key properties of 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine?
1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine has a molecular weight of 381.43 g/mol, XLogP of 2.36, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methyl]-3-methylsulfonylguanidine is sourced from PubChem (CID 46379169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).