C21H35N5O3 — CID 46381316
1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 46381316) has the molecular formula C21H35N5O3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46381316 |
| Molecular Formula | C21H35N5O3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | CC1CCCN(CCCNC(=O)C2CCN(c3cc(=O)n(C)c(=O)n3C)CC2)C1 |
| InChI | InChI=1S/C21H35N5O3/c1-16-6-4-10-25(15-16)11-5-9-22-20(28)17-7-12-26(13-8-17)18-14-19(27)24(3)21(29)23(18)2/h14,16-17H,4-13,15H2,1-3H3,(H,22,28) |
| InChIKey | LAVFMVOZFGJJDQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|