C20H33N5O4 — CID 46381357
1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide (PubChem CID 46381357) has the molecular formula C20H33N5O4 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46381357 |
| Molecular Formula | C20H33N5O4 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide |
| SMILES | CCn1c(N2CCC(C(=O)NCCCN3CCOCC3)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C20H33N5O4/c1-3-25-17(15-18(26)22(2)20(25)28)24-9-5-16(6-10-24)19(27)21-7-4-8-23-11-13-29-14-12-23/h15-16H,3-14H2,1-2H3,(H,21,27) |
| InChIKey | GNQHYMUQZZYWOU-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 88.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|