C17H16N2O4S2 — CID 46388736
4-acetyl-N-[3-(4-oxo-1,3-thiazolidin-2-yl)phenyl]benzenesulfonamide (PubChem CID 46388736) has the molecular formula C17H16N2O4S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-acetyl-N-[3-(4-oxo-1,3-thiazolidin-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-acetyl-N-[3-(4-oxo-1,3-thiazolidin-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46388736 |
| Molecular Formula | C17H16N2O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 4-acetyl-N-[3-(4-oxo-1,3-thiazolidin-2-yl)phenyl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)Nc2cccc(C3NC(=O)CS3)c2)cc1 |
| InChI | InChI=1S/C17H16N2O4S2/c1-11(20)12-5-7-15(8-6-12)25(22,23)19-14-4-2-3-13(9-14)17-18-16(21)10-24-17/h2-9,17,19H,10H2,1H3,(H,18,21) |
| InChIKey | LAVIORTWKIJHAY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |