C18H15ClN4O2S2 — CID 46392729
N-[4-(6-chloro-1,3-benzothiazol-2-yl)phenyl]-1-ethylpyrazole-4-sulfonamide (PubChem CID 46392729) has the molecular formula C18H15ClN4O2S2 and a molecular weight of 418.93 g/mol. Its IUPAC name is N-[4-(6-chloro-1,3-benzothiazol-2-yl)phenyl]-1-ethylpyrazole-4-sulfonamide.
| Compound Name | N-[4-(6-chloro-1,3-benzothiazol-2-yl)phenyl]-1-ethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 46392729 |
| Molecular Formula | C18H15ClN4O2S2 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | N-[4-(6-chloro-1,3-benzothiazol-2-yl)phenyl]-1-ethylpyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)Nc2ccc(-c3nc4ccc(Cl)cc4s3)cc2)cn1 |
| InChI | InChI=1S/C18H15ClN4O2S2/c1-2-23-11-15(10-20-23)27(24,25)22-14-6-3-12(4-7-14)18-21-16-8-5-13(19)9-17(16)26-18/h3-11,22H,2H2,1H3 |
| InChIKey | GSJJELYYMQNXJB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |