C24H27N5O4 — CID 46393187
ethyl 3-[[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]carbamoylamino]benzoate (PubChem CID 46393187) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is ethyl 3-[[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]carbamoylamino]benzoate.
| Compound Name | ethyl 3-[[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 46393187 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | ethyl 3-[[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)NC2CCN(c3nc4ccccc4n(C)c3=O)CC2)c1 |
| InChI | InChI=1S/C24H27N5O4/c1-3-33-23(31)16-7-6-8-18(15-16)26-24(32)25-17-11-13-29(14-12-17)21-22(30)28(2)20-10-5-4-9-19(20)27-21/h4-10,15,17H,3,11-14H2,1-2H3,(H2,25,26,32) |
| InChIKey | MBTUAICAHQHORI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |