C24H29N5O2 — CID 50837429
1-(2-methylphenyl)-3-[1-(3-oxo-4-propylquinoxalin-2-yl)piperidin-4-yl]urea (PubChem CID 50837429) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[1-(3-oxo-4-propylquinoxalin-2-yl)piperidin-4-yl]urea.
| Compound Name | 1-(2-methylphenyl)-3-[1-(3-oxo-4-propylquinoxalin-2-yl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 50837429 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 1-(2-methylphenyl)-3-[1-(3-oxo-4-propylquinoxalin-2-yl)piperidin-4-yl]urea |
| SMILES | CCCn1c(=O)c(N2CCC(NC(=O)Nc3ccccc3C)CC2)nc2ccccc21 |
| InChI | InChI=1S/C24H29N5O2/c1-3-14-29-21-11-7-6-10-20(21)26-22(23(29)30)28-15-12-18(13-16-28)25-24(31)27-19-9-5-4-8-17(19)2/h4-11,18H,3,12-16H2,1-2H3,(H2,25,27,31) |
| InChIKey | HPVURGXDUMXCLS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |