C24H29N5O4 — CID 46393118
1-(2,4-dimethoxyphenyl)-3-[1-(4-ethyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea (PubChem CID 46393118) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[1-(4-ethyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[1-(4-ethyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 46393118 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[1-(4-ethyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea |
| SMILES | CCn1c(=O)c(N2CCC(NC(=O)Nc3ccc(OC)cc3OC)CC2)nc2ccccc21 |
| InChI | InChI=1S/C24H29N5O4/c1-4-29-20-8-6-5-7-18(20)26-22(23(29)30)28-13-11-16(12-14-28)25-24(31)27-19-10-9-17(32-2)15-21(19)33-3/h5-10,15-16H,4,11-14H2,1-3H3,(H2,25,27,31) |
| InChIKey | ATLPAHXLPLQVDL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |