C22H25N5O3 — CID 46393180
1-(2-methoxyphenyl)-3-[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea (PubChem CID 46393180) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 46393180 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea |
| SMILES | COc1ccccc1NC(=O)NC1CCN(c2nc3ccccc3n(C)c2=O)CC1 |
| InChI | InChI=1S/C22H25N5O3/c1-26-18-9-5-3-7-16(18)24-20(21(26)28)27-13-11-15(12-14-27)23-22(29)25-17-8-4-6-10-19(17)30-2/h3-10,15H,11-14H2,1-2H3,(H2,23,25,29) |
| InChIKey | RLEQRQWNUITZTH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |