C21H22ClN5O2 — CID 46393184
1-(3-chlorophenyl)-3-[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea (PubChem CID 46393184) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 46393184 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[1-(4-methyl-3-oxoquinoxalin-2-yl)piperidin-4-yl]urea |
| SMILES | Cn1c(=O)c(N2CCC(NC(=O)Nc3cccc(Cl)c3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C21H22ClN5O2/c1-26-18-8-3-2-7-17(18)25-19(20(26)28)27-11-9-15(10-12-27)23-21(29)24-16-6-4-5-14(22)13-16/h2-8,13,15H,9-12H2,1H3,(H2,23,24,29) |
| InChIKey | ZPXZRFJWNCFMRL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |