C23H25ClN6O2 — CID 53021749
1-(3-chloro-2-methylphenyl)-3-[1-(3-oxo-4-prop-2-enylpyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]urea (PubChem CID 53021749) has the molecular formula C23H25ClN6O2 and a molecular weight of 452.95 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[1-(3-oxo-4-prop-2-enylpyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]urea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[1-(3-oxo-4-prop-2-enylpyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 53021749 |
| Molecular Formula | C23H25ClN6O2 |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[1-(3-oxo-4-prop-2-enylpyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]urea |
| SMILES | C=CCn1c(=O)c(N2CCC(NC(=O)Nc3cccc(Cl)c3C)CC2)nc2cccnc21 |
| InChI | InChI=1S/C23H25ClN6O2/c1-3-12-30-20-19(8-5-11-25-20)27-21(22(30)31)29-13-9-16(10-14-29)26-23(32)28-18-7-4-6-17(24)15(18)2/h3-8,11,16H,1,9-10,12-14H2,2H3,(H2,26,28,32) |
| InChIKey | BOIXJZPSQZAUGN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|