About 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide
1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide (PubChem CID 50781195) has the molecular formula C16H21N5O2
and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide |
| PubChem CID | 50781195 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide |
| SMILES | CCn1c(=O)c(N2CCC(C(=O)NC)CC2)nc2cccnc21 |
| InChI | InChI=1S/C16H21N5O2/c1-3-21-13-12(5-4-8-18-13)19-14(16(21)23)20-9-6-11(7-10-20)15(22)17-2/h4-5,8,11H,3,6-7,9-10H2,1-2H3,(H,17,22) |
| InChIKey | NRQJIADFNLGTOS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide?
The IUPAC name of 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide (CID 50781195) is 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide.
What is the SMILES notation for 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide?
The canonical SMILES for 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide is CCn1c(=O)c(N2CCC(C(=O)NC)CC2)nc2cccnc21.
What is the InChIKey of 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide?
The InChIKey is NRQJIADFNLGTOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5O2/c1-3-21-13-12(5-4-8-18-13)19-14(16(21)23)20-9-6-11(7-10-20)15(22)17-2/h4-5,8,11H,3,6-7,9-10H2,1-2H3,(H,17,22).
What are the key properties of 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide?
1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide has a molecular weight of 315.38 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-methylpiperidine-4-carboxamide is sourced from PubChem (CID 50781195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).