C23H28N6O3 — CID 53021717
1-[1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]-3-(2-methoxyethyl)urea (PubChem CID 53021717) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 1-[1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 53021717 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 1-[1-(4-benzyl-3-oxopyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)NC1CCN(c2nc3cccnc3n(Cc3ccccc3)c2=O)CC1 |
| InChI | InChI=1S/C23H28N6O3/c1-32-15-12-25-23(31)26-18-9-13-28(14-10-18)21-22(30)29(16-17-6-3-2-4-7-17)20-19(27-21)8-5-11-24-20/h2-8,11,18H,9-10,12-16H2,1H3,(H2,25,26,31) |
| InChIKey | PMKQHOGFLIEWJI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|