C19H26N6O2 — CID 83272856
1-[1-(3-oxo-4-prop-2-enylpyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]-3-propan-2-ylurea (PubChem CID 83272856) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 1-[1-(3-oxo-4-prop-2-enylpyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]-3-propan-2-ylurea.
| Compound Name | 1-[1-(3-oxo-4-prop-2-enylpyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 83272856 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-[1-(3-oxo-4-prop-2-enylpyrido[2,3-b]pyrazin-2-yl)piperidin-4-yl]-3-propan-2-ylurea |
| SMILES | C=CCn1c(=O)c(N2CCC(NC(=O)NC(C)C)CC2)nc2cccnc21 |
| InChI | InChI=1S/C19H26N6O2/c1-4-10-25-16-15(6-5-9-20-16)23-17(18(25)26)24-11-7-14(8-12-24)22-19(27)21-13(2)3/h4-6,9,13-14H,1,7-8,10-12H2,2-3H3,(H2,21,22,27) |
| InChIKey | NVAMXHUAVADHDJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|