C23H25N5O2 — CID 87050144
2-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]-4-prop-2-enylpyrido[2,3-b]pyrazin-3-one (PubChem CID 87050144) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]-4-prop-2-enylpyrido[2,3-b]pyrazin-3-one.
| Compound Name | 2-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]-4-prop-2-enylpyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 87050144 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]-4-prop-2-enylpyrido[2,3-b]pyrazin-3-one |
| SMILES | C=CCn1c(=O)c(N2CCN(C(=O)Cc3cccc(C)c3)CC2)nc2cccnc21 |
| InChI | InChI=1S/C23H25N5O2/c1-3-10-28-21-19(8-5-9-24-21)25-22(23(28)30)27-13-11-26(12-14-27)20(29)16-18-7-4-6-17(2)15-18/h3-9,15H,1,10-14,16H2,2H3 |
| InChIKey | VQUNNZBIQOMVEA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|