C14H20N4O3 — CID 46395102
2-(1-ethyl-3-methyl-7-oxopyrazolo[5,4-c]pyridin-6-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 46395102) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(1-ethyl-3-methyl-7-oxopyrazolo[5,4-c]pyridin-6-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(1-ethyl-3-methyl-7-oxopyrazolo[5,4-c]pyridin-6-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 46395102 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-(1-ethyl-3-methyl-7-oxopyrazolo[5,4-c]pyridin-6-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | CCn1nc(C)c2ccn(CC(=O)NCCOC)c(=O)c21 |
| InChI | InChI=1S/C14H20N4O3/c1-4-18-13-11(10(2)16-18)5-7-17(14(13)20)9-12(19)15-6-8-21-3/h5,7H,4,6,8-9H2,1-3H3,(H,15,19) |
| InChIKey | OXFMEUPDWBIPOY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|