C22H28N4O3 — CID 46395124
N-[(4-butoxyphenyl)methyl]-2-(1-ethyl-3-methyl-7-oxopyrazolo[5,4-c]pyridin-6-yl)acetamide (PubChem CID 46395124) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-2-(1-ethyl-3-methyl-7-oxopyrazolo[5,4-c]pyridin-6-yl)acetamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-2-(1-ethyl-3-methyl-7-oxopyrazolo[5,4-c]pyridin-6-yl)acetamide |
|---|---|
| PubChem CID | 46395124 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-2-(1-ethyl-3-methyl-7-oxopyrazolo[5,4-c]pyridin-6-yl)acetamide |
| SMILES | CCCCOc1ccc(CNC(=O)Cn2ccc3c(C)nn(CC)c3c2=O)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-4-6-13-29-18-9-7-17(8-10-18)14-23-20(27)15-25-12-11-19-16(3)24-26(5-2)21(19)22(25)28/h7-12H,4-6,13-15H2,1-3H3,(H,23,27) |
| InChIKey | VWVVIQMISUVIBA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|