C23H26N4O3 — CID 46397311
N-butyl-3-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxoquinazoline-7-carboxamide (PubChem CID 46397311) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-butyl-3-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxoquinazoline-7-carboxamide.
| Compound Name | N-butyl-3-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxoquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 46397311 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-butyl-3-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxoquinazoline-7-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(=O)n(CC(=O)Nc3c(C)cccc3C)cnc2c1 |
| InChI | InChI=1S/C23H26N4O3/c1-4-5-11-24-22(29)17-9-10-18-19(12-17)25-14-27(23(18)30)13-20(28)26-21-15(2)7-6-8-16(21)3/h6-10,12,14H,4-5,11,13H2,1-3H3,(H,24,29)(H,26,28) |
| InChIKey | IKUWNJQSQCITOI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|