C11H8N4O2S2 — CID 46398736
3-(4-methoxyphenyl)-7-sulfanylidene-6H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one (PubChem CID 46398736) has the molecular formula C11H8N4O2S2 and a molecular weight of 292.35 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-7-sulfanylidene-6H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one.
| Compound Name | 3-(4-methoxyphenyl)-7-sulfanylidene-6H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 46398736 |
| Molecular Formula | C11H8N4O2S2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 3-(4-methoxyphenyl)-7-sulfanylidene-6H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
| SMILES | COc1ccc(-c2nnc3sc(=S)[nH]n3c2=O)cc1 |
| InChI | InChI=1S/C11H8N4O2S2/c1-17-7-4-2-6(3-5-7)8-9(16)15-10(13-12-8)19-11(18)14-15/h2-5H,1H3,(H,14,18) |
| InChIKey | JDFVSRAXTBSAGC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|