C12H10N4O3S2 — CID 82554742
3-(3,4-dimethoxyphenyl)-7-sulfanylidene-6H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one (PubChem CID 82554742) has the molecular formula C12H10N4O3S2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-7-sulfanylidene-6H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-7-sulfanylidene-6H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 82554742 |
| Molecular Formula | C12H10N4O3S2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-7-sulfanylidene-6H-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
| SMILES | COc1ccc(-c2nnc3sc(=S)[nH]n3c2=O)cc1OC |
| InChI | InChI=1S/C12H10N4O3S2/c1-18-7-4-3-6(5-8(7)19-2)9-10(17)16-11(14-13-9)21-12(20)15-16/h3-5H,1-2H3,(H,15,20) |
| InChIKey | XQFMHHGHGWGFEB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|