C16H20N4O2S — CID 46405088
methyl 4-[[(4-cyclopropyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-methylamino]methyl]benzoate (PubChem CID 46405088) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is methyl 4-[[(4-cyclopropyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-methylamino]methyl]benzoate.
| Compound Name | methyl 4-[[(4-cyclopropyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 46405088 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | methyl 4-[[(4-cyclopropyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-methylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C)Cn2ncn(C3CC3)c2=S)cc1 |
| InChI | InChI=1S/C16H20N4O2S/c1-18(9-12-3-5-13(6-4-12)15(21)22-2)11-20-16(23)19(10-17-20)14-7-8-14/h3-6,10,14H,7-9,11H2,1-2H3 |
| InChIKey | FCXULHIMXHMXFP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|