C25H33NO3S — CID 46419968
N-[1-(4-cyclohexylphenyl)-2-methylpropyl]-3-(methylsulfonylmethyl)benzamide (PubChem CID 46419968) has the molecular formula C25H33NO3S and a molecular weight of 427.61 g/mol. Its IUPAC name is N-[1-(4-cyclohexylphenyl)-2-methylpropyl]-3-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[1-(4-cyclohexylphenyl)-2-methylpropyl]-3-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 46419968 |
| Molecular Formula | C25H33NO3S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | N-[1-(4-cyclohexylphenyl)-2-methylpropyl]-3-(methylsulfonylmethyl)benzamide |
| SMILES | CC(C)C(NC(=O)c1cccc(CS(C)(=O)=O)c1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H33NO3S/c1-18(2)24(22-14-12-21(13-15-22)20-9-5-4-6-10-20)26-25(27)23-11-7-8-19(16-23)17-30(3,28)29/h7-8,11-16,18,20,24H,4-6,9-10,17H2,1-3H3,(H,26,27) |
| InChIKey | GCZOGJXEVQNFOV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |