C14H25N3OS — CID 4642075
1-piperidin-1-yl-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)ethanone (PubChem CID 4642075) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is 1-piperidin-1-yl-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)ethanone.
| Compound Name | 1-piperidin-1-yl-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)ethanone |
|---|---|
| PubChem CID | 4642075 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-piperidin-1-yl-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)ethanone |
| SMILES | CC1CC(C)(C)NC(=S)N1CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H25N3OS/c1-11-9-14(2,3)15-13(19)17(11)10-12(18)16-7-5-4-6-8-16/h11H,4-10H2,1-3H3,(H,15,19) |
| InChIKey | FJYWQQUJEAMSME-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|