C21H31N3OS — CID 3264280
1-(4-benzylpiperidin-1-yl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)ethanone (PubChem CID 3264280) has the molecular formula C21H31N3OS and a molecular weight of 373.57 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)ethanone |
|---|---|
| PubChem CID | 3264280 |
| Molecular Formula | C21H31N3OS |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)ethanone |
| SMILES | CC1CC(C)(C)NC(=S)N1CC(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H31N3OS/c1-16-14-21(2,3)22-20(26)24(16)15-19(25)23-11-9-18(10-12-23)13-17-7-5-4-6-8-17/h4-8,16,18H,9-15H2,1-3H3,(H,22,26) |
| InChIKey | XCSSWTBPIOXQSW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|