C29H29N3O3 — CID 5182758
3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 5182758) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 5182758 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H29N3O3/c33-26(31-18-16-23(17-19-31)20-22-10-4-1-5-11-22)21-32-27(34)29(30-28(32)35,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-15,23H,16-21H2,(H,30,35) |
| InChIKey | VGQHFEMFJVEKMF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|