C22H22N6O2S — CID 46435151
3-(oxolan-2-ylmethyl)-2-[1-(1-phenyltetrazol-5-yl)ethylsulfanyl]quinazolin-4-one (PubChem CID 46435151) has the molecular formula C22H22N6O2S and a molecular weight of 434.53 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethyl)-2-[1-(1-phenyltetrazol-5-yl)ethylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(oxolan-2-ylmethyl)-2-[1-(1-phenyltetrazol-5-yl)ethylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 46435151 |
| Molecular Formula | C22H22N6O2S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-(oxolan-2-ylmethyl)-2-[1-(1-phenyltetrazol-5-yl)ethylsulfanyl]quinazolin-4-one |
| SMILES | CC(Sc1nc2ccccc2c(=O)n1CC1CCCO1)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C22H22N6O2S/c1-15(20-24-25-26-28(20)16-8-3-2-4-9-16)31-22-23-19-12-6-5-11-18(19)21(29)27(22)14-17-10-7-13-30-17/h2-6,8-9,11-12,15,17H,7,10,13-14H2,1H3 |
| InChIKey | SRKIIIUPLGFRIQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |