C22H23FN2O4S — CID 46443034
N-[3-(4-fluorophenoxy)propyl]-3-methoxy-N-methyl-4-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 46443034) has the molecular formula C22H23FN2O4S and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[3-(4-fluorophenoxy)propyl]-3-methoxy-N-methyl-4-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-[3-(4-fluorophenoxy)propyl]-3-methoxy-N-methyl-4-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46443034 |
| Molecular Formula | C22H23FN2O4S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[3-(4-fluorophenoxy)propyl]-3-methoxy-N-methyl-4-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | COc1cc(C(=O)N(C)CCCOc2ccc(F)cc2)ccc1OCc1cscn1 |
| InChI | InChI=1S/C22H23FN2O4S/c1-25(10-3-11-28-19-7-5-17(23)6-8-19)22(26)16-4-9-20(21(12-16)27-2)29-13-18-14-30-15-24-18/h4-9,12,14-15H,3,10-11,13H2,1-2H3 |
| InChIKey | DUVGASZGYCDJHC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|