C16H19N3O4S — CID 46455985
2-cyclopent-2-en-1-yl-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 46455985) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-cyclopent-2-en-1-yl-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46455985 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CC1C=CCC1)N1CCN(C(=O)c2ccc([N+](=O)[O-])s2)CC1 |
| InChI | InChI=1S/C16H19N3O4S/c20-14(11-12-3-1-2-4-12)17-7-9-18(10-8-17)16(21)13-5-6-15(24-13)19(22)23/h1,3,5-6,12H,2,4,7-11H2 |
| InChIKey | UDPDNAWXSVFHOU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|