C20H17FN4O4S — CID 46456266
[4-(7-fluoro-2-methylquinoline-3-carbonyl)piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone (PubChem CID 46456266) has the molecular formula C20H17FN4O4S and a molecular weight of 428.45 g/mol. Its IUPAC name is [4-(7-fluoro-2-methylquinoline-3-carbonyl)piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone.
| Compound Name | [4-(7-fluoro-2-methylquinoline-3-carbonyl)piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 46456266 |
| Molecular Formula | C20H17FN4O4S |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [4-(7-fluoro-2-methylquinoline-3-carbonyl)piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone |
| SMILES | Cc1nc2cc(F)ccc2cc1C(=O)N1CCN(C(=O)c2ccc([N+](=O)[O-])s2)CC1 |
| InChI | InChI=1S/C20H17FN4O4S/c1-12-15(10-13-2-3-14(21)11-16(13)22-12)19(26)23-6-8-24(9-7-23)20(27)17-4-5-18(30-17)25(28)29/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | KLLKPXKYDJPBCB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|