C17H11BrN2O2S — CID 46459730
1,3-benzothiazol-2-ylmethyl 3-bromo-1H-indole-2-carboxylate (PubChem CID 46459730) has the molecular formula C17H11BrN2O2S and a molecular weight of 387.26 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-bromo-1H-indole-2-carboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-bromo-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 46459730 |
| Molecular Formula | C17H11BrN2O2S |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-bromo-1H-indole-2-carboxylate |
| SMILES | O=C(OCc1nc2ccccc2s1)c1[nH]c2ccccc2c1Br |
| InChI | InChI=1S/C17H11BrN2O2S/c18-15-10-5-1-2-6-11(10)20-16(15)17(21)22-9-14-19-12-7-3-4-8-13(12)23-14/h1-8,20H,9H2 |
| InChIKey | HZCRFEHYHJYBFJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |