C26H38N4O4 — CID 46474300
2-methoxyethyl 2,4-dimethyl-5-[4-[4-(3-methylphenyl)piperazin-1-yl]butylcarbamoyl]-1H-pyrrole-3-carboxylate (PubChem CID 46474300) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2-methoxyethyl 2,4-dimethyl-5-[4-[4-(3-methylphenyl)piperazin-1-yl]butylcarbamoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | 2-methoxyethyl 2,4-dimethyl-5-[4-[4-(3-methylphenyl)piperazin-1-yl]butylcarbamoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 46474300 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 2-methoxyethyl 2,4-dimethyl-5-[4-[4-(3-methylphenyl)piperazin-1-yl]butylcarbamoyl]-1H-pyrrole-3-carboxylate |
| SMILES | COCCOC(=O)c1c(C)[nH]c(C(=O)NCCCCN2CCN(c3cccc(C)c3)CC2)c1C |
| InChI | InChI=1S/C26H38N4O4/c1-19-8-7-9-22(18-19)30-14-12-29(13-15-30)11-6-5-10-27-25(31)24-20(2)23(21(3)28-24)26(32)34-17-16-33-4/h7-9,18,28H,5-6,10-17H2,1-4H3,(H,27,31) |
| InChIKey | WPPQOQIZUHLKCV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|