C18H24N2O3S — CID 4647858
2-(2,6-diethyl-3,5-dioxothiomorpholin-4-yl)-N-(2-phenylethyl)acetamide (PubChem CID 4647858) has the molecular formula C18H24N2O3S and a molecular weight of 348.50 g/mol. Its IUPAC name is 2-(2,6-diethyl-3,5-dioxothiomorpholin-4-yl)-N-(2-phenylethyl)acetamide.
| Compound Name | 2-(2,6-diethyl-3,5-dioxothiomorpholin-4-yl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 4647858 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-(2,6-diethyl-3,5-dioxothiomorpholin-4-yl)-N-(2-phenylethyl)acetamide |
| SMILES | CCC1C(=O)N(C(=O)C(S1)CC)CC(=O)NCCC2=CC=CC=C2 |
| InChI | InChI=1S/C18H24N2O3S/c1-3-14-17(22)20(18(23)15(4-2)24-14)12-16(21)19-11-10-13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-12H2,1-2H3,(H,19,21) |
| InChIKey | RXVSOCNCOAJAOI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | 441 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|