C25H28N2O5 — CID 46479062
1,3-dioxo-2-(oxolan-2-ylmethyl)-N-[1-(3-propan-2-yloxyphenyl)ethyl]isoindole-5-carboxamide (PubChem CID 46479062) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1,3-dioxo-2-(oxolan-2-ylmethyl)-N-[1-(3-propan-2-yloxyphenyl)ethyl]isoindole-5-carboxamide.
| Compound Name | 1,3-dioxo-2-(oxolan-2-ylmethyl)-N-[1-(3-propan-2-yloxyphenyl)ethyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 46479062 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1,3-dioxo-2-(oxolan-2-ylmethyl)-N-[1-(3-propan-2-yloxyphenyl)ethyl]isoindole-5-carboxamide |
| SMILES | CC(C)Oc1cccc(C(C)NC(=O)c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)c1 |
| InChI | InChI=1S/C25H28N2O5/c1-15(2)32-19-7-4-6-17(12-19)16(3)26-23(28)18-9-10-21-22(13-18)25(30)27(24(21)29)14-20-8-5-11-31-20/h4,6-7,9-10,12-13,15-16,20H,5,8,11,14H2,1-3H3,(H,26,28) |
| InChIKey | WMZUZIQPKOBUBB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|