C22H19ClF3N5O2 — CID 46480448
1-(4-chlorophenyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 46480448) has the molecular formula C22H19ClF3N5O2 and a molecular weight of 477.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46480448 |
| Molecular Formula | C22H19ClF3N5O2 |
| Molecular Weight | 477.87 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C1CN(c2ccc(CNC(=O)c3cnn(-c4ccc(Cl)cc4)c3C(F)(F)F)cc2)CCN1 |
| InChI | InChI=1S/C22H19ClF3N5O2/c23-15-3-7-17(8-4-15)31-20(22(24,25)26)18(12-29-31)21(33)28-11-14-1-5-16(6-2-14)30-10-9-27-19(32)13-30/h1-8,12H,9-11,13H2,(H,27,32)(H,28,33) |
| InChIKey | KTCYBWOLQACFDG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|