C19H23N3O3S — CID 4649075
4-(3,4-dimethoxyphenyl)-3-ethyl-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-4-ol (PubChem CID 4649075) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-3-ethyl-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-4-ol.
| Compound Name | 4-(3,4-dimethoxyphenyl)-3-ethyl-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-4-ol |
|---|---|
| PubChem CID | 4649075 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-3-ethyl-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-4-ol |
| SMILES | CCN1/C(=N/Cc2cccnc2)SCC1(O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H23N3O3S/c1-4-22-18(21-12-14-6-5-9-20-11-14)26-13-19(22,23)15-7-8-16(24-2)17(10-15)25-3/h5-11,23H,4,12-13H2,1-3H3/b21-18- |
| InChIKey | QNBSMXHMQJHUEB-UZYVYHOESA-N |
| XLogP | 2.87 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|