C19H23N3OS — CID 3395003
3-ethyl-4-(4-ethylphenyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-4-ol (PubChem CID 3395003) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 3-ethyl-4-(4-ethylphenyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-4-ol.
| Compound Name | 3-ethyl-4-(4-ethylphenyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-4-ol |
|---|---|
| PubChem CID | 3395003 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-ethyl-4-(4-ethylphenyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-4-ol |
| SMILES | CCc1ccc(C2(O)CS/C(=N\Cc3cccnc3)N2CC)cc1 |
| InChI | InChI=1S/C19H23N3OS/c1-3-15-7-9-17(10-8-15)19(23)14-24-18(22(19)4-2)21-13-16-6-5-11-20-12-16/h5-12,23H,3-4,13-14H2,1-2H3/b21-18- |
| InChIKey | JNANEKMXJBAULU-UZYVYHOESA-N |
| XLogP | 3.41 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|