C14H16N2OS2 — CID 145001099
4-hydroxy-4-[(2E)-penta-2,4-dien-2-yl]-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione (PubChem CID 145001099) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-hydroxy-4-[(2E)-penta-2,4-dien-2-yl]-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione.
| Compound Name | 4-hydroxy-4-[(2E)-penta-2,4-dien-2-yl]-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 145001099 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-hydroxy-4-[(2E)-penta-2,4-dien-2-yl]-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione |
| SMILES | C=C/C=C(\C)C1(O)CSC(=S)N1Cc1cccnc1 |
| InChI | InChI=1S/C14H16N2OS2/c1-3-5-11(2)14(17)10-19-13(18)16(14)9-12-6-4-7-15-8-12/h3-8,17H,1,9-10H2,2H3/b11-5+ |
| InChIKey | XQXFSAMCEMWQBS-VZUCSPMQSA-N |
| XLogP | 2.74 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|