C17H20N2O3S2 — CID 145001134
4-[(3E)-2,5-dimethoxyhexa-1,3,5-trien-3-yl]-4-hydroxy-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione (PubChem CID 145001134) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[(3E)-2,5-dimethoxyhexa-1,3,5-trien-3-yl]-4-hydroxy-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione.
| Compound Name | 4-[(3E)-2,5-dimethoxyhexa-1,3,5-trien-3-yl]-4-hydroxy-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 145001134 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 4-[(3E)-2,5-dimethoxyhexa-1,3,5-trien-3-yl]-4-hydroxy-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione |
| SMILES | C=C(/C=C(\C(=C)OC)C1(O)CSC(=S)N1Cc1cccnc1)OC |
| InChI | InChI=1S/C17H20N2O3S2/c1-12(21-3)8-15(13(2)22-4)17(20)11-24-16(23)19(17)10-14-6-5-7-18-9-14/h5-9,20H,1-2,10-11H2,3-4H3/b15-8+ |
| InChIKey | COLPTJGQVQMMNL-OVCLIPMQSA-N |
| XLogP | 2.85 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|