C11H13NO — CID 89227055
6-ethylazecin-3-ol (PubChem CID 89227055) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 6-ethylazecin-3-ol.
| Compound Name | 6-ethylazecin-3-ol |
|---|---|
| PubChem CID | 89227055 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 6-ethylazecin-3-ol |
| SMILES | CCc1ccccncc(O)cc1 |
| InChI | InChI=1S/C11H13NO/c1-2-10-5-3-4-8-12-9-11(13)7-6-10/h3-9,13H,2H2,1H3/b4-3-,5-3+,7-6-,8-4-,10-5+,10-6-,11-7+,11-9-,12-8-,12-9+ |
| InChIKey | ZFIFTUMDUNQKFR-GJEUBCQWSA-N |
| XLogP | 2.47 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |