C24H39ClN4O2 — CID 46493944
1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea (PubChem CID 46493944) has the molecular formula C24H39ClN4O2 and a molecular weight of 451.06 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea |
|---|---|
| PubChem CID | 46493944 |
| Molecular Formula | C24H39ClN4O2 |
| Molecular Weight | 451.06 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(3-ethyl-2-morpholin-4-ylpentyl)urea |
| SMILES | CCC(CC)C(CNC(=O)NC1CCN(Cc2ccc(Cl)cc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C24H39ClN4O2/c1-3-20(4-2)23(29-13-15-31-16-14-29)17-26-24(30)27-22-9-11-28(12-10-22)18-19-5-7-21(25)8-6-19/h5-8,20,22-23H,3-4,9-18H2,1-2H3,(H2,26,27,30) |
| InChIKey | DARDFQKDEXQXBP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.06 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |