C23H20ClN3O4 — CID 46496308
2-chloro-N-[3-[[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 46496308) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is 2-chloro-N-[3-[[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46496308 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-chloro-N-[3-[[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cccc(NC(=O)c3ccccc3Cl)c2)cc1OC |
| InChI | InChI=1S/C23H20ClN3O4/c1-30-20-11-10-15(12-21(20)31-2)14-25-27-22(28)16-6-5-7-17(13-16)26-23(29)18-8-3-4-9-19(18)24/h3-14H,1-2H3,(H,26,29)(H,27,28)/b25-14+ |
| InChIKey | OMHDYCUYJSXONL-AFUMVMLFSA-N |
| XLogP | 4.37 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|