C12H11N7O4S — CID 46496939
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(6-nitrobenzotriazol-1-yl)oxyacetamide (PubChem CID 46496939) has the molecular formula C12H11N7O4S and a molecular weight of 349.33 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(6-nitrobenzotriazol-1-yl)oxyacetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(6-nitrobenzotriazol-1-yl)oxyacetamide |
|---|---|
| PubChem CID | 46496939 |
| Molecular Formula | C12H11N7O4S |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(6-nitrobenzotriazol-1-yl)oxyacetamide |
| SMILES | CCc1nnc(NC(=O)COn2nnc3ccc([N+](=O)[O-])cc32)s1 |
| InChI | InChI=1S/C12H11N7O4S/c1-2-11-15-16-12(24-11)13-10(20)6-23-18-9-5-7(19(21)22)3-4-8(9)14-17-18/h3-5H,2,6H2,1H3,(H,13,16,20) |
| InChIKey | HRPASRIXDWRQDI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|