C11H9N7O4S2 — CID 3979689
N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(6-nitrobenzotriazol-1-yl)oxyacetamide (PubChem CID 3979689) has the molecular formula C11H9N7O4S2 and a molecular weight of 367.37 g/mol. Its IUPAC name is N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(6-nitrobenzotriazol-1-yl)oxyacetamide.
| Compound Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(6-nitrobenzotriazol-1-yl)oxyacetamide |
|---|---|
| PubChem CID | 3979689 |
| Molecular Formula | C11H9N7O4S2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(6-nitrobenzotriazol-1-yl)oxyacetamide |
| SMILES | CSc1nnc(NC(=O)COn2nnc3ccc([N+](=O)[O-])cc32)s1 |
| InChI | InChI=1S/C11H9N7O4S2/c1-23-11-15-14-10(24-11)12-9(19)5-22-17-8-4-6(18(20)21)2-3-7(8)13-16-17/h2-4H,5H2,1H3,(H,12,14,19) |
| InChIKey | UFEBBLDKLOLFFO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|