C20H23N3O3 — CID 46499189
N-[(Z)-3-(3-ethoxypropylamino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 46499189) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[(Z)-3-(3-ethoxypropylamino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-(3-ethoxypropylamino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46499189 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[(Z)-3-(3-ethoxypropylamino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | CCOCCCNC(=O)/C(=C/c1cccnc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O3/c1-2-26-13-7-12-22-20(25)18(14-16-8-6-11-21-15-16)23-19(24)17-9-4-3-5-10-17/h3-6,8-11,14-15H,2,7,12-13H2,1H3,(H,22,25)(H,23,24)/b18-14- |
| InChIKey | XLMYPPILYZCWJX-JXAWBTAJSA-N |
| XLogP | 2.40 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|