About [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate
[4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate (PubChem CID 46499779) has the molecular formula C17H11BrClNO5
and a molecular weight of 424.63 g/mol. Its IUPAC name is [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate.
Molecular Properties
| Compound Name | [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate |
| PubChem CID | 46499779 |
| Molecular Formula | C17H11BrClNO5 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate |
| SMILES | O=C1OC(OC(=O)c2ccccc2Br)C(Nc2cccc(O)c2)=C1Cl |
| InChI | InChI=1S/C17H11BrClNO5/c18-12-7-2-1-6-11(12)15(22)24-17-14(13(19)16(23)25-17)20-9-4-3-5-10(21)8-9/h1-8,17,20-21H |
| InChIKey | MJUCHZXGLUQVOG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate?
The IUPAC name of [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate (CID 46499779) is [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate.
What is the SMILES notation for [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate?
The canonical SMILES for [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate is O=C1OC(OC(=O)c2ccccc2Br)C(Nc2cccc(O)c2)=C1Cl.
What is the InChIKey of [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate?
The InChIKey is MJUCHZXGLUQVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11BrClNO5/c18-12-7-2-1-6-11(12)15(22)24-17-14(13(19)16(23)25-17)20-9-4-3-5-10(21)8-9/h1-8,17,20-21H.
What are the key properties of [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate?
[4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate has a molecular weight of 424.63 g/mol, XLogP of 3.76, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-3-(3-hydroxyanilino)-5-oxo-2H-furan-2-yl] 2-bromobenzoate is sourced from PubChem (CID 46499779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).