C21H19ClN6O2 — CID 46500299
3-(4-chlorophenyl)-N-[(E)-1-(3,4-dimethoxyphenyl)ethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 46500299) has the molecular formula C21H19ClN6O2 and a molecular weight of 422.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[(E)-1-(3,4-dimethoxyphenyl)ethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-(4-chlorophenyl)-N-[(E)-1-(3,4-dimethoxyphenyl)ethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 46500299 |
| Molecular Formula | C21H19ClN6O2 |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[(E)-1-(3,4-dimethoxyphenyl)ethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | COc1ccc(/C(C)=N/Nc2ccc3nnc(-c4ccc(Cl)cc4)n3n2)cc1OC |
| InChI | InChI=1S/C21H19ClN6O2/c1-13(15-6-9-17(29-2)18(12-15)30-3)23-24-19-10-11-20-25-26-21(28(20)27-19)14-4-7-16(22)8-5-14/h4-12H,1-3H3,(H,24,27)/b23-13+ |
| InChIKey | LUCIDIYXQIIMJV-YDZHTSKRSA-N |
| XLogP | 4.30 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|